About 1-phenylimidazolidine-2,4,5-trione
1-phenylimidazolidine-2,4,5-trione (PubChem CID 577259) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 1-phenylimidazolidine-2,4,5-trione.
Molecular Properties
| Compound Name | 1-phenylimidazolidine-2,4,5-trione |
| PubChem CID | 577259 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1-phenylimidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C9H6N2O3/c12-7-8(13)11(9(14)10-7)6-4-2-1-3-5-6/h1-5H,(H,10,12,14) |
| InChIKey | AVIPDXGMHBJIGG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylimidazolidine-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylimidazolidine-2,4,5-trione?
The IUPAC name of 1-phenylimidazolidine-2,4,5-trione (CID 577259) is 1-phenylimidazolidine-2,4,5-trione.
What is the SMILES notation for 1-phenylimidazolidine-2,4,5-trione?
The canonical SMILES for 1-phenylimidazolidine-2,4,5-trione is O=C1NC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of 1-phenylimidazolidine-2,4,5-trione?
The InChIKey is AVIPDXGMHBJIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-7-8(13)11(9(14)10-7)6-4-2-1-3-5-6/h1-5H,(H,10,12,14).
What are the key properties of 1-phenylimidazolidine-2,4,5-trione?
1-phenylimidazolidine-2,4,5-trione has a molecular weight of 190.16 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylimidazolidine-2,4,5-trione is sourced from PubChem (CID 577259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).