About 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine
4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine (PubChem CID 577294) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine.
Molecular Properties
| Compound Name | 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine |
| PubChem CID | 577294 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine |
| SMILES | Cc1ccc(Cc2cc(C)ncc2C)c(C)c1 |
| InChI | InChI=1S/C16H19N/c1-11-5-6-15(12(2)7-11)9-16-8-14(4)17-10-13(16)3/h5-8,10H,9H2,1-4H3 |
| InChIKey | UXLQVMDEZHZLBO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine?
The IUPAC name of 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine (CID 577294) is 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine.
What is the SMILES notation for 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine?
The canonical SMILES for 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine is Cc1ccc(Cc2cc(C)ncc2C)c(C)c1.
What is the InChIKey of 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine?
The InChIKey is UXLQVMDEZHZLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-11-5-6-15(12(2)7-11)9-16-8-14(4)17-10-13(16)3/h5-8,10H,9H2,1-4H3.
What are the key properties of 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine?
4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine has a molecular weight of 225.33 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethylphenyl)methyl]-2,5-dimethylpyridine is sourced from PubChem (CID 577294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).