About 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide
4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 577347) has the molecular formula C17H14N2OS
and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 577347 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H14N2OS/c1-12-7-9-14(10-8-12)16(20)19-17-18-15(11-21-17)13-5-3-2-4-6-13/h2-11H,1H3,(H,18,19,20) |
| InChIKey | NERONVMZIDSIRT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CID 577347) is 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is Cc1ccc(C(=O)Nc2nc(-c3ccccc3)cs2)cc1.
What is the InChIKey of 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is NERONVMZIDSIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2OS/c1-12-7-9-14(10-8-12)16(20)19-17-18-15(11-21-17)13-5-3-2-4-6-13/h2-11H,1H3,(H,18,19,20).
What are the key properties of 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 294.38 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 577347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).