C21H17FN2O2 — CID 577368
2-fluoro-N-[4-[(4-methylbenzoyl)amino]phenyl]benzamide (PubChem CID 577368) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-fluoro-N-[4-[(4-methylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[(4-methylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 577368 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-fluoro-N-[4-[(4-methylbenzoyl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NC(=O)c3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C21H17FN2O2/c1-14-6-8-15(9-7-14)20(25)23-16-10-12-17(13-11-16)24-21(26)18-4-2-3-5-19(18)22/h2-13H,1H3,(H,23,25)(H,24,26) |
| InChIKey | KHLBUULYSSYOLM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |