About 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane
10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane (PubChem CID 577397) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane.
Molecular Properties
| Compound Name | 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane |
| PubChem CID | 577397 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane |
| SMILES | C=C1CCCC(=C)C2CC(C)(C)C2CC1 |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h13-14H,1-2,5-10H2,3-4H3 |
| InChIKey | PMMLIVYPEUJENN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane?
The IUPAC name of 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane (CID 577397) is 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane.
What is the SMILES notation for 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane?
The canonical SMILES for 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane is C=C1CCCC(=C)C2CC(C)(C)C2CC1.
What is the InChIKey of 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane?
The InChIKey is PMMLIVYPEUJENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h13-14H,1-2,5-10H2,3-4H3.
What are the key properties of 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane?
10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane has a molecular weight of 204.36 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-2,6-dimethylidenebicyclo[7.2.0]undecane is sourced from PubChem (CID 577397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).