C15H15N3O2S2 — CID 577518
N-(2,5-dimethylphenyl)-5-methyl-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 577518) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-5-methyl-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(2,5-dimethylphenyl)-5-methyl-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 577518 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(2,5-dimethylphenyl)-5-methyl-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2c(C)ccc3nsnc23)c1 |
| InChI | InChI=1S/C15H15N3O2S2/c1-9-4-5-10(2)13(8-9)18-22(19,20)15-11(3)6-7-12-14(15)17-21-16-12/h4-8,18H,1-3H3 |
| InChIKey | PFNUUUINXPEFHV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|