About 4-acetamidobenzamide
4-acetamidobenzamide (PubChem CID 577727) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-acetamidobenzamide.
Molecular Properties
| Compound Name | 4-acetamidobenzamide |
| PubChem CID | 577727 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-acetamidobenzamide |
| SMILES | CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C9H10N2O2/c1-6(12)11-8-4-2-7(3-5-8)9(10)13/h2-5H,1H3,(H2,10,13)(H,11,12) |
| InChIKey | XVVYSVVBPMJRAB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-acetamidobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamidobenzamide?
The IUPAC name of 4-acetamidobenzamide (CID 577727) is 4-acetamidobenzamide.
What is the SMILES notation for 4-acetamidobenzamide?
The canonical SMILES for 4-acetamidobenzamide is CC(=O)Nc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-acetamidobenzamide?
The InChIKey is XVVYSVVBPMJRAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-6(12)11-8-4-2-7(3-5-8)9(10)13/h2-5H,1H3,(H2,10,13)(H,11,12).
What are the key properties of 4-acetamidobenzamide?
4-acetamidobenzamide has a molecular weight of 178.19 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamidobenzamide is sourced from PubChem (CID 577727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).