About 4-amino-N-ethylbenzamide
4-amino-N-ethylbenzamide (PubChem CID 577773) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-amino-N-ethylbenzamide.
Molecular Properties
| Compound Name | 4-amino-N-ethylbenzamide |
| PubChem CID | 577773 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-amino-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H12N2O/c1-2-11-9(12)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3,(H,11,12) |
| InChIKey | DROBNRGIMGTXHP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-ethylbenzamide?
The IUPAC name of 4-amino-N-ethylbenzamide (CID 577773) is 4-amino-N-ethylbenzamide.
What is the SMILES notation for 4-amino-N-ethylbenzamide?
The canonical SMILES for 4-amino-N-ethylbenzamide is CCNC(=O)c1ccc(N)cc1.
What is the InChIKey of 4-amino-N-ethylbenzamide?
The InChIKey is DROBNRGIMGTXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-11-9(12)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3,(H,11,12).
What are the key properties of 4-amino-N-ethylbenzamide?
4-amino-N-ethylbenzamide has a molecular weight of 164.21 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-ethylbenzamide is sourced from PubChem (CID 577773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).