About N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide
N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide (PubChem CID 577887) has the molecular formula C15H13N3O5
and a molecular weight of 315.29 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide |
| PubChem CID | 577887 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C15H13N3O5/c1-9-3-4-10(2)14(5-9)16-15(19)11-6-12(17(20)21)8-13(7-11)18(22)23/h3-8H,1-2H3,(H,16,19) |
| InChIKey | PJNWKWJELQOMOC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide?
The IUPAC name of N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide (CID 577887) is N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide.
What is the SMILES notation for N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide?
The canonical SMILES for N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide is Cc1ccc(C)c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1.
What is the InChIKey of N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide?
The InChIKey is PJNWKWJELQOMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O5/c1-9-3-4-10(2)14(5-9)16-15(19)11-6-12(17(20)21)8-13(7-11)18(22)23/h3-8H,1-2H3,(H,16,19).
What are the key properties of N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide?
N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide has a molecular weight of 315.29 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylphenyl)-3,5-dinitrobenzamide is sourced from PubChem (CID 577887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).