About (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate
(4-methoxyphenyl)methyl 2,2,2-trifluoroacetate (PubChem CID 577980) has the molecular formula C10H9F3O3
and a molecular weight of 234.17 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate |
| PubChem CID | 577980 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(COC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F3O3/c1-15-8-4-2-7(3-5-8)6-16-9(14)10(11,12)13/h2-5H,6H2,1H3 |
| InChIKey | BSBVVLYNTXIZSP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate?
The IUPAC name of (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate (CID 577980) is (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate.
What is the SMILES notation for (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate?
The canonical SMILES for (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate is COc1ccc(COC(=O)C(F)(F)F)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate?
The InChIKey is BSBVVLYNTXIZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O3/c1-15-8-4-2-7(3-5-8)6-16-9(14)10(11,12)13/h2-5H,6H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate?
(4-methoxyphenyl)methyl 2,2,2-trifluoroacetate has a molecular weight of 234.17 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 577980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).