About (4-nitrophenyl) 2-hydroxybenzoate
(4-nitrophenyl) 2-hydroxybenzoate (PubChem CID 578045) has the molecular formula C13H9NO5
and a molecular weight of 259.22 g/mol. Its IUPAC name is (4-nitrophenyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 2-hydroxybenzoate |
| PubChem CID | 578045 |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (4-nitrophenyl) 2-hydroxybenzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1O |
| InChI | InChI=1S/C13H9NO5/c15-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)14(17)18/h1-8,15H |
| InChIKey | XSTIAAYONYIWGB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 2-hydroxybenzoate?
The IUPAC name of (4-nitrophenyl) 2-hydroxybenzoate (CID 578045) is (4-nitrophenyl) 2-hydroxybenzoate.
What is the SMILES notation for (4-nitrophenyl) 2-hydroxybenzoate?
The canonical SMILES for (4-nitrophenyl) 2-hydroxybenzoate is O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1O.
What is the InChIKey of (4-nitrophenyl) 2-hydroxybenzoate?
The InChIKey is XSTIAAYONYIWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO5/c15-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)14(17)18/h1-8,15H.
What are the key properties of (4-nitrophenyl) 2-hydroxybenzoate?
(4-nitrophenyl) 2-hydroxybenzoate has a molecular weight of 259.22 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 2-hydroxybenzoate is sourced from PubChem (CID 578045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).