About CID 57806605
CID 57806605 (PubChem CID 57806605) has the molecular formula C24H10F2N2O2Pt
and a molecular weight of 591.40 g/mol.
Molecular Properties
| Compound Name | CID 57806605 |
| PubChem CID | 57806605 |
| Molecular Formula | C24H10F2N2O2Pt |
| Molecular Weight | 591.40 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | — |
| SMILES | C1=CC2=[C-]C(=C1)C(=O)C3=CC=CC(=N3)C4=C(C=C(C(=[C-]4)C5=NC(=CC=C5)C2=O)F)F.[Pt+2] |
| InChI | InChI=1S/C24H10F2N2O2.Pt/c25-17-12-18(26)16-11-15(17)19-6-2-8-21(27-19)23(29)13-4-1-5-14(10-13)24(30)22-9-3-7-20(16)28-22;/h1-9,12H;/q-2;+2 |
| InChIKey | NFXUMSVQUHLHOI-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 59.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | 930 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 591.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 57806605 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57806605?
The IUPAC name of CID 57806605 (CID 57806605) is not available.
What is the SMILES notation for CID 57806605?
The canonical SMILES for CID 57806605 is C1=CC2=[C-]C(=C1)C(=O)C3=CC=CC(=N3)C4=C(C=C(C(=[C-]4)C5=NC(=CC=C5)C2=O)F)F.[Pt+2].
What is the InChIKey of CID 57806605?
The InChIKey is NFXUMSVQUHLHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H10F2N2O2.Pt/c25-17-12-18(26)16-11-15(17)19-6-2-8-21(27-19)23(29)13-4-1-5-14(10-13)24(30)22-9-3-7-20(16)28-22;/h1-9,12H;/q-2;+2.
What are the key properties of CID 57806605?
CID 57806605 has a molecular weight of 591.40 g/mol, XLogP of not available, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57806605 is sourced from PubChem (CID 57806605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).