About 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one
3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one (PubChem CID 57822033) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one.
Molecular Properties
| Compound Name | 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one |
| PubChem CID | 57822033 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one |
| SMILES | CC(C)C1=C(NCN(C1=O)C)C(C)C |
| InChI | InChI=1S/C11H20N2O/c1-7(2)9-10(8(3)4)12-6-13(5)11(9)14/h7-8,12H,6H2,1-5H3 |
| InChIKey | KYZRPZSFGLPBCG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 266 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one?
The IUPAC name of 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one (CID 57822033) is 3-methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one.
What is the SMILES notation for 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one?
The canonical SMILES for 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one is CC(C)C1=C(NCN(C1=O)C)C(C)C.
What is the InChIKey of 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one?
The InChIKey is KYZRPZSFGLPBCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-7(2)9-10(8(3)4)12-6-13(5)11(9)14/h7-8,12H,6H2,1-5H3.
What are the key properties of 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one?
3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one has a molecular weight of 196.29 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methyl-5,6-di(propan-2-yl)-1,2-dihydropyrimidin-4-one is sourced from PubChem (CID 57822033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).