About 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea
1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea (PubChem CID 578299) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea |
| PubChem CID | 578299 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NN=C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O/c1-11-7-6-8-12(2)14(11)16-15(19)18-17-13-9-4-3-5-10-13/h6-8H,3-5,9-10H2,1-2H3,(H2,16,18,19) |
| InChIKey | KZRRUAKHCDPXLF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea?
The IUPAC name of 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea (CID 578299) is 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea.
What is the SMILES notation for 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea?
The canonical SMILES for 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea is Cc1cccc(C)c1NC(=O)NN=C1CCCCC1.
What is the InChIKey of 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea?
The InChIKey is KZRRUAKHCDPXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-11-7-6-8-12(2)14(11)16-15(19)18-17-13-9-4-3-5-10-13/h6-8H,3-5,9-10H2,1-2H3,(H2,16,18,19).
What are the key properties of 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea?
1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea has a molecular weight of 259.35 g/mol, XLogP of 3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylideneamino)-3-(2,6-dimethylphenyl)urea is sourced from PubChem (CID 578299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).