About (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate
(3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate (PubChem CID 578313) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 578313 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC1=C(C)CC(COC(=O)C(C)(C)C)([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H23NO4/c1-10-6-7-14(15(17)18,8-11(10)2)9-19-12(16)13(3,4)5/h6-9H2,1-5H3 |
| InChIKey | OJETVNKACRBQFO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate (CID 578313) is (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate is CC1=C(C)CC(COC(=O)C(C)(C)C)([N+](=O)[O-])CC1.
What is the InChIKey of (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate?
The InChIKey is OJETVNKACRBQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO4/c1-10-6-7-14(15(17)18,8-11(10)2)9-19-12(16)13(3,4)5/h6-9H2,1-5H3.
What are the key properties of (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate?
(3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate has a molecular weight of 269.34 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-1-nitrocyclohex-3-en-1-yl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 578313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).