About 2-bromo-2-phenylethanol
2-bromo-2-phenylethanol (PubChem CID 578332) has the molecular formula C8H9BrO
and a molecular weight of 201.06 g/mol. Its IUPAC name is 2-bromo-2-phenylethanol.
Molecular Properties
| Compound Name | 2-bromo-2-phenylethanol |
| PubChem CID | 578332 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 2-bromo-2-phenylethanol |
| SMILES | OCC(Br)c1ccccc1 |
| InChI | InChI=1S/C8H9BrO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6H2 |
| InChIKey | QXOPAHUDEPTDQJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-phenylethanol?
The IUPAC name of 2-bromo-2-phenylethanol (CID 578332) is 2-bromo-2-phenylethanol.
What is the SMILES notation for 2-bromo-2-phenylethanol?
The canonical SMILES for 2-bromo-2-phenylethanol is OCC(Br)c1ccccc1.
What is the InChIKey of 2-bromo-2-phenylethanol?
The InChIKey is QXOPAHUDEPTDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6H2.
What are the key properties of 2-bromo-2-phenylethanol?
2-bromo-2-phenylethanol has a molecular weight of 201.06 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-phenylethanol is sourced from PubChem (CID 578332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).