About (4-ethylphenyl)hydrazine
(4-ethylphenyl)hydrazine (PubChem CID 578421) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (4-ethylphenyl)hydrazine.
Molecular Properties
| Compound Name | (4-ethylphenyl)hydrazine |
| PubChem CID | 578421 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (4-ethylphenyl)hydrazine |
| SMILES | CCc1ccc(NN)cc1 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-5-8(10-9)6-4-7/h3-6,10H,2,9H2,1H3 |
| InChIKey | JYPNYAHCNKRLHG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)hydrazine?
The IUPAC name of (4-ethylphenyl)hydrazine (CID 578421) is (4-ethylphenyl)hydrazine.
What is the SMILES notation for (4-ethylphenyl)hydrazine?
The canonical SMILES for (4-ethylphenyl)hydrazine is CCc1ccc(NN)cc1.
What is the InChIKey of (4-ethylphenyl)hydrazine?
The InChIKey is JYPNYAHCNKRLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-7-3-5-8(10-9)6-4-7/h3-6,10H,2,9H2,1H3.
What are the key properties of (4-ethylphenyl)hydrazine?
(4-ethylphenyl)hydrazine has a molecular weight of 136.20 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)hydrazine is sourced from PubChem (CID 578421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).