C9H10N8 — CID 578661
6-(3,5-dimethylpyrazol-1-yl)-3-methyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine (PubChem CID 578661) has the molecular formula C9H10N8 and a molecular weight of 230.23 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-3-methyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-3-methyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine |
|---|---|
| PubChem CID | 578661 |
| Molecular Formula | C9H10N8 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-3-methyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine |
| SMILES | Cc1cc(C)n(-c2nnc3nnc(C)n3n2)n1 |
| InChI | InChI=1S/C9H10N8/c1-5-4-6(2)16(14-5)9-13-12-8-11-10-7(3)17(8)15-9/h4H,1-3H3 |
| InChIKey | KIYGYIMXPBKDLZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 86.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |