C23H32O5 — CID 578883
9-hydroxy-10-(hydroxymethyl)-3,6,6,14,14,17-hexamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-dien-18-one (PubChem CID 578883) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 9-hydroxy-10-(hydroxymethyl)-3,6,6,14,14,17-hexamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-dien-18-one.
| Compound Name | 9-hydroxy-10-(hydroxymethyl)-3,6,6,14,14,17-hexamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-dien-18-one |
|---|---|
| PubChem CID | 578883 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 9-hydroxy-10-(hydroxymethyl)-3,6,6,14,14,17-hexamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-dien-18-one |
| SMILES | CC1=CC23C(=O)C(C=C(CO)C(O)C24OC(C)(C)OC14)C1C(CC3C)C1(C)C |
| InChI | InChI=1S/C23H32O5/c1-11-9-22-12(2)7-15-16(20(15,3)4)14(18(22)26)8-13(10-24)17(25)23(22)19(11)27-21(5,6)28-23/h8-9,12,14-17,19,24-25H,7,10H2,1-6H3 |
| InChIKey | GPEOYGNGCJGFSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|