C8H8N2O3 — CID 579053
3-nitro-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one (PubChem CID 579053) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 3-nitro-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one.
| Compound Name | 3-nitro-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one |
|---|---|
| PubChem CID | 579053 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 3-nitro-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one |
| SMILES | O=c1[nH]c2c(cc1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C8H8N2O3/c11-8-7(10(12)13)4-5-2-1-3-6(5)9-8/h4H,1-3H2,(H,9,11) |
| InChIKey | JJNYQLUGEHFZIW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|