About 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid
1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 579189) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 579189 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCCC2C(=O)O)c(C)o1 |
| InChI | InChI=1S/C12H15NO4/c1-7-6-9(8(2)17-7)11(14)13-5-3-4-10(13)12(15)16/h6,10H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | SEFHWPWYVWQJKX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid (CID 579189) is 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid is Cc1cc(C(=O)N2CCCC2C(=O)O)c(C)o1.
What is the InChIKey of 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid?
The InChIKey is SEFHWPWYVWQJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-7-6-9(8(2)17-7)11(14)13-5-3-4-10(13)12(15)16/h6,10H,3-5H2,1-2H3,(H,15,16).
What are the key properties of 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid?
1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid has a molecular weight of 237.25 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylfuran-3-carbonyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 579189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).