About 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one
9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one (PubChem CID 579311) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one.
Molecular Properties
| Compound Name | 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one |
| PubChem CID | 579311 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one |
| SMILES | CC(C)=CC(=O)C=C(C)CCCc1ccoc1 |
| InChI | InChI=1S/C15H20O2/c1-12(2)9-15(16)10-13(3)5-4-6-14-7-8-17-11-14/h7-11H,4-6H2,1-3H3 |
| InChIKey | KPYPPWAWICYALB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one?
The IUPAC name of 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one (CID 579311) is 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one.
What is the SMILES notation for 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one?
The canonical SMILES for 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one is CC(C)=CC(=O)C=C(C)CCCc1ccoc1.
What is the InChIKey of 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one?
The InChIKey is KPYPPWAWICYALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-12(2)9-15(16)10-13(3)5-4-6-14-7-8-17-11-14/h7-11H,4-6H2,1-3H3.
What are the key properties of 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one?
9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one has a molecular weight of 232.32 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(furan-3-yl)-2,6-dimethylnona-2,5-dien-4-one is sourced from PubChem (CID 579311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).