About N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide
N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide (PubChem CID 579391) has the molecular formula C11H10FN3O3
and a molecular weight of 251.22 g/mol. Its IUPAC name is N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide |
| PubChem CID | 579391 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide |
| SMILES | O=C1CC(NNC(=O)c2cccc(F)c2)C(=O)N1 |
| InChI | InChI=1S/C11H10FN3O3/c12-7-3-1-2-6(4-7)10(17)15-14-8-5-9(16)13-11(8)18/h1-4,8,14H,5H2,(H,15,17)(H,13,16,18) |
| InChIKey | ZUPRPRMCJDARFK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide?
The IUPAC name of N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide (CID 579391) is N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide.
What is the SMILES notation for N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide?
The canonical SMILES for N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide is O=C1CC(NNC(=O)c2cccc(F)c2)C(=O)N1.
What is the InChIKey of N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide?
The InChIKey is ZUPRPRMCJDARFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O3/c12-7-3-1-2-6(4-7)10(17)15-14-8-5-9(16)13-11(8)18/h1-4,8,14H,5H2,(H,15,17)(H,13,16,18).
What are the key properties of N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide?
N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide has a molecular weight of 251.22 g/mol, XLogP of -0.52, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,5-dioxopyrrolidin-3-yl)-3-fluorobenzohydrazide is sourced from PubChem (CID 579391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).