About di(cyclopenta-2,4-dien-1-yl)-dimethylsilane
di(cyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 579493) has the molecular formula C12H16Si
and a molecular weight of 188.35 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)-dimethylsilane.
Molecular Properties
| Compound Name | di(cyclopenta-2,4-dien-1-yl)-dimethylsilane |
| PubChem CID | 579493 |
| Molecular Formula | C12H16Si |
| Molecular Weight | 188.35 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C12H16Si/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12/h3-12H,1-2H3 |
| InChIKey | VQAKYCZDETUXFW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(cyclopenta-2,4-dien-1-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The IUPAC name of di(cyclopenta-2,4-dien-1-yl)-dimethylsilane (CID 579493) is di(cyclopenta-2,4-dien-1-yl)-dimethylsilane.
What is the SMILES notation for di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The canonical SMILES for di(cyclopenta-2,4-dien-1-yl)-dimethylsilane is C[Si](C)(C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The InChIKey is VQAKYCZDETUXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Si/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12/h3-12H,1-2H3.
What are the key properties of di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
di(cyclopenta-2,4-dien-1-yl)-dimethylsilane has a molecular weight of 188.35 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclopenta-2,4-dien-1-yl)-dimethylsilane is sourced from PubChem (CID 579493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).