About N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine
N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine (PubChem CID 579620) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine |
| PubChem CID | 579620 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine |
| SMILES | CNCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C8H15N3/c1-6-8(5-9-3)7(2)11(4)10-6/h9H,5H2,1-4H3 |
| InChIKey | DBORGGVCQYVMEP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine?
The IUPAC name of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine (CID 579620) is N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine.
What is the SMILES notation for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine?
The canonical SMILES for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine is CNCc1c(C)nn(C)c1C.
What is the InChIKey of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine?
The InChIKey is DBORGGVCQYVMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-6-8(5-9-3)7(2)11(4)10-6/h9H,5H2,1-4H3.
What are the key properties of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine?
N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine has a molecular weight of 153.23 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine is sourced from PubChem (CID 579620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).