About 2,3-dipyridin-2-ylbutane-2,3-diol
2,3-dipyridin-2-ylbutane-2,3-diol (PubChem CID 579625) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2,3-dipyridin-2-ylbutane-2,3-diol.
Molecular Properties
| Compound Name | 2,3-dipyridin-2-ylbutane-2,3-diol |
| PubChem CID | 579625 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2,3-dipyridin-2-ylbutane-2,3-diol |
| SMILES | CC(O)(c1ccccn1)C(C)(O)c1ccccn1 |
| InChI | InChI=1S/C14H16N2O2/c1-13(17,11-7-3-5-9-15-11)14(2,18)12-8-4-6-10-16-12/h3-10,17-18H,1-2H3 |
| InChIKey | RUJGNUFYBYBFFP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dipyridin-2-ylbutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-2-ylbutane-2,3-diol?
The IUPAC name of 2,3-dipyridin-2-ylbutane-2,3-diol (CID 579625) is 2,3-dipyridin-2-ylbutane-2,3-diol.
What is the SMILES notation for 2,3-dipyridin-2-ylbutane-2,3-diol?
The canonical SMILES for 2,3-dipyridin-2-ylbutane-2,3-diol is CC(O)(c1ccccn1)C(C)(O)c1ccccn1.
What is the InChIKey of 2,3-dipyridin-2-ylbutane-2,3-diol?
The InChIKey is RUJGNUFYBYBFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-13(17,11-7-3-5-9-15-11)14(2,18)12-8-4-6-10-16-12/h3-10,17-18H,1-2H3.
What are the key properties of 2,3-dipyridin-2-ylbutane-2,3-diol?
2,3-dipyridin-2-ylbutane-2,3-diol has a molecular weight of 244.29 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-2-ylbutane-2,3-diol is sourced from PubChem (CID 579625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).