About 1,3,4,5-tetramethylpyrazole
1,3,4,5-tetramethylpyrazole (PubChem CID 579642) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,3,4,5-tetramethylpyrazole.
Molecular Properties
| Compound Name | 1,3,4,5-tetramethylpyrazole |
| PubChem CID | 579642 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,3,4,5-tetramethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1C |
| InChI | InChI=1S/C7H12N2/c1-5-6(2)8-9(4)7(5)3/h1-4H3 |
| InChIKey | DUAZFYUNWBILMU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,4,5-tetramethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4,5-tetramethylpyrazole?
The IUPAC name of 1,3,4,5-tetramethylpyrazole (CID 579642) is 1,3,4,5-tetramethylpyrazole.
What is the SMILES notation for 1,3,4,5-tetramethylpyrazole?
The canonical SMILES for 1,3,4,5-tetramethylpyrazole is Cc1nn(C)c(C)c1C.
What is the InChIKey of 1,3,4,5-tetramethylpyrazole?
The InChIKey is DUAZFYUNWBILMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-5-6(2)8-9(4)7(5)3/h1-4H3.
What are the key properties of 1,3,4,5-tetramethylpyrazole?
1,3,4,5-tetramethylpyrazole has a molecular weight of 124.19 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4,5-tetramethylpyrazole is sourced from PubChem (CID 579642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).