About 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine
2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 579759) has the molecular formula C13H21N5
and a molecular weight of 247.35 g/mol. Its IUPAC name is 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine |
| PubChem CID | 579759 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | Cc1cc(C)nc(N/C(N)=N/C2CCCCC2)n1 |
| InChI | InChI=1S/C13H21N5/c1-9-8-10(2)16-13(15-9)18-12(14)17-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | OFJULBSMJCEMCG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The IUPAC name of 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine (CID 579759) is 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine.
What is the SMILES notation for 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The canonical SMILES for 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine is Cc1cc(C)nc(N/C(N)=N/C2CCCCC2)n1.
What is the InChIKey of 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
The InChIKey is OFJULBSMJCEMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5/c1-9-8-10(2)16-13(15-9)18-12(14)17-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H3,14,15,16,17,18).
What are the key properties of 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine?
2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine has a molecular weight of 247.35 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-(4,6-dimethylpyrimidin-2-yl)guanidine is sourced from PubChem (CID 579759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).