C17H16F2N2O2 — CID 579782
2-fluoro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 579782) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-fluoro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 579782 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-fluoro-N-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NCCc1ccccc1F |
| InChI | InChI=1S/C17H16F2N2O2/c18-14-7-3-1-5-12(14)9-10-20-16(22)11-21-17(23)13-6-2-4-8-15(13)19/h1-8H,9-11H2,(H,20,22)(H,21,23) |
| InChIKey | JUFZERMRZQCQLT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |