About 4-benzyl-1,3,5-trimethylpyrazole
4-benzyl-1,3,5-trimethylpyrazole (PubChem CID 579801) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 4-benzyl-1,3,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 4-benzyl-1,3,5-trimethylpyrazole |
| PubChem CID | 579801 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-benzyl-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2/c1-10-13(11(2)15(3)14-10)9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3 |
| InChIKey | QYVBDODVVLOQNZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyl-1,3,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1,3,5-trimethylpyrazole?
The IUPAC name of 4-benzyl-1,3,5-trimethylpyrazole (CID 579801) is 4-benzyl-1,3,5-trimethylpyrazole.
What is the SMILES notation for 4-benzyl-1,3,5-trimethylpyrazole?
The canonical SMILES for 4-benzyl-1,3,5-trimethylpyrazole is Cc1nn(C)c(C)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-1,3,5-trimethylpyrazole?
The InChIKey is QYVBDODVVLOQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-10-13(11(2)15(3)14-10)9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3.
What are the key properties of 4-benzyl-1,3,5-trimethylpyrazole?
4-benzyl-1,3,5-trimethylpyrazole has a molecular weight of 200.29 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1,3,5-trimethylpyrazole is sourced from PubChem (CID 579801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).