C12H19NO3 — CID 579924
7a-acetyl-3-tert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 579924) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 7a-acetyl-3-tert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | 7a-acetyl-3-tert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 579924 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 7a-acetyl-3-tert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CC(=O)C12CCCN1C(C(C)(C)C)OC2=O |
| InChI | InChI=1S/C12H19NO3/c1-8(14)12-6-5-7-13(12)9(11(2,3)4)16-10(12)15/h9H,5-7H2,1-4H3 |
| InChIKey | HLEUSXDJSHMKRT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|