About 2,3-diaminophenol
2,3-diaminophenol (PubChem CID 579937) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 2,3-diaminophenol.
Molecular Properties
| Compound Name | 2,3-diaminophenol |
| PubChem CID | 579937 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 2,3-diaminophenol |
| SMILES | Nc1cccc(O)c1N |
| InChI | InChI=1S/C6H8N2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,7-8H2 |
| InChIKey | PCAXITAPTVOLGL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diaminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminophenol?
The IUPAC name of 2,3-diaminophenol (CID 579937) is 2,3-diaminophenol.
What is the SMILES notation for 2,3-diaminophenol?
The canonical SMILES for 2,3-diaminophenol is Nc1cccc(O)c1N.
What is the InChIKey of 2,3-diaminophenol?
The InChIKey is PCAXITAPTVOLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,7-8H2.
What are the key properties of 2,3-diaminophenol?
2,3-diaminophenol has a molecular weight of 124.14 g/mol, XLogP of 0.56, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminophenol is sourced from PubChem (CID 579937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).