C20H40N4O — CID 579978
N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]acetamide (PubChem CID 579978) has the molecular formula C20H40N4O and a molecular weight of 352.57 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]acetamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 579978 |
| Molecular Formula | C20H40N4O |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]acetamide |
| SMILES | CC1(C)CC(NCC(=O)NC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H40N4O/c1-17(2)9-14(10-18(3,4)23-17)21-13-16(25)22-15-11-19(5,6)24-20(7,8)12-15/h14-15,21,23-24H,9-13H2,1-8H3,(H,22,25) |
| InChIKey | CMBCMPYRBVJZDI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |