C22H42N4O2 — CID 579979
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)butanediamide (PubChem CID 579979) has the molecular formula C22H42N4O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)butanediamide.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 579979 |
| Molecular Formula | C22H42N4O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)butanediamide |
| SMILES | CC1(C)CC(NC(=O)CCC(=O)NC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H42N4O2/c1-19(2)11-15(12-20(3,4)25-19)23-17(27)9-10-18(28)24-16-13-21(5,6)26-22(7,8)14-16/h15-16,25-26H,9-14H2,1-8H3,(H,23,27)(H,24,28) |
| InChIKey | KVGKANWUAULXNI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |