C36H40ClF2N3O5Si — CID 58000012
5-amino-3-[(5-chloro-2,4-difluorophenyl)methyl]-7-[(2,4-dimethoxyphenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinoline-6,8-dione (PubChem CID 58000012) has the molecular formula C36H40ClF2N3O5Si and a molecular weight of 696.27 g/mol. Its IUPAC name is 5-amino-3-[(5-chloro-2,4-difluorophenyl)methyl]-7-[(2,4-dimethoxyphenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinoline-6,8-dione.
| Compound Name | 5-amino-3-[(5-chloro-2,4-difluorophenyl)methyl]-7-[(2,4-dimethoxyphenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinoline-6,8-dione |
|---|---|
| PubChem CID | 58000012 |
| Molecular Formula | C36H40ClF2N3O5Si |
| Molecular Weight | 696.27 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | 5-amino-3-[(5-chloro-2,4-difluorophenyl)methyl]-7-[(2,4-dimethoxyphenyl)methyl]-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinoline-6,8-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(c(O[Si](C(C)C)(C(C)C)C(C)C)c4ncc(Cc5cc(Cl)c(F)cc5F)cc4c3N)C2=O)c(OC)c1 |
| InChI | InChI=1S/C36H40ClF2N3O5Si/c1-18(2)48(19(3)4,20(5)6)47-34-31-30(35(43)42(36(31)44)17-22-9-10-24(45-7)14-29(22)46-8)32(40)25-12-21(16-41-33(25)34)11-23-13-26(37)28(39)15-27(23)38/h9-10,12-16,18-20H,11,17,40H2,1-8H3 |
| InChIKey | LHQMPDYZAFFXHB-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.27 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|