C32H33FN2O6Si — CID 58000030
7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-9-hydroxy-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinoline-6,8-dione (PubChem CID 58000030) has the molecular formula C32H33FN2O6Si and a molecular weight of 588.71 g/mol. Its IUPAC name is 7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-9-hydroxy-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinoline-6,8-dione.
| Compound Name | 7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-9-hydroxy-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinoline-6,8-dione |
|---|---|
| PubChem CID | 58000030 |
| Molecular Formula | C32H33FN2O6Si |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-9-hydroxy-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinoline-6,8-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(c(O)c4ncc(Cc5ccc(F)cc5)cc4c3OCC[Si](C)(C)C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C32H33FN2O6Si/c1-39-23-11-8-21(25(16-23)40-2)18-35-31(37)26-27(32(35)38)30(41-12-13-42(3,4)5)24-15-20(17-34-28(24)29(26)36)14-19-6-9-22(33)10-7-19/h6-11,15-17,36H,12-14,18H2,1-5H3 |
| InChIKey | JCFWITYHTKUYKB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|