C41H32F4N2O7S — CID 58000065
[9-benzhydryloxy-7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate (PubChem CID 58000065) has the molecular formula C41H32F4N2O7S and a molecular weight of 772.77 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate.
| Compound Name | [9-benzhydryloxy-7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58000065 |
| Molecular Formula | C41H32F4N2O7S |
| Molecular Weight | 772.77 g/mol |
| Exact Mass | 772.19 |
| IUPAC Name | [9-benzhydryloxy-7-[(2,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CN2Cc3c(c(OC(c4ccccc4)c4ccccc4)c4ncc(Cc5ccc(F)cc5)cc4c3OS(=O)(=O)C(F)(F)F)C2=O)c(OC)c1 |
| InChI | InChI=1S/C41H32F4N2O7S/c1-51-31-18-15-29(34(21-31)52-2)23-47-24-33-35(40(47)48)39(53-37(27-9-5-3-6-10-27)28-11-7-4-8-12-28)36-32(38(33)54-55(49,50)41(43,44)45)20-26(22-46-36)19-25-13-16-30(42)17-14-25/h3-18,20-22,37H,19,23-24H2,1-2H3 |
| InChIKey | ZGWGNWNUZVJDRS-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.77 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|