C21H34FN7O4 — CID 58000542
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000542) has the molecular formula C21H34FN7O4 and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000542 |
| Molecular Formula | C21H34FN7O4 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]-5-fluoro-2-methoxypyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | COc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCN(C)[C@H](C)C2)n1 |
| InChI | InChI=1S/C21H34FN7O4/c1-14-11-28(9-8-27(14)2)19-17(22)18(23-21(24-19)33-3)25-26-20(31)16(12-29(32)13-30)10-15-6-4-5-7-15/h13-16,32H,4-12H2,1-3H3,(H,26,31)(H,23,24,25)/t14-,16-/m1/s1 |
| InChIKey | FLHJXMUQGONSTQ-GDBMZVCRSA-N |
| XLogP | 1.25 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|