C21H33F2N7O3 — CID 58000549
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000549) has the molecular formula C21H33F2N7O3 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000549 |
| Molecular Formula | C21H33F2N7O3 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoro-2-(fluoromethyl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | C[C@@H]1CN(C)CCN1c1nc(CF)nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c1F |
| InChI | InChI=1S/C21H33F2N7O3/c1-14-11-28(2)7-8-30(14)20-18(23)19(24-17(10-22)25-20)26-27-21(32)16(12-29(33)13-31)9-15-5-3-4-6-15/h13-16,33H,3-12H2,1-2H3,(H,27,32)(H,24,25,26)/t14-,16-/m1/s1 |
| InChIKey | ODWXYMHVXXOGTA-GDBMZVCRSA-N |
| XLogP | 1.71 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|