C19H29FN6O4 — CID 58000555
N-[(2R)-2-(cyclopentylmethyl)-3-[2-[2-ethyl-5-fluoro-6-(1,2-oxazolidin-2-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000555) has the molecular formula C19H29FN6O4 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[(2R)-2-(cyclopentylmethyl)-3-[2-[2-ethyl-5-fluoro-6-(1,2-oxazolidin-2-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[2-ethyl-5-fluoro-6-(1,2-oxazolidin-2-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000555 |
| Molecular Formula | C19H29FN6O4 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-[(2R)-2-(cyclopentylmethyl)-3-[2-[2-ethyl-5-fluoro-6-(1,2-oxazolidin-2-yl)pyrimidin-4-yl]hydrazinyl]-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CCc1nc(NNC(=O)[C@H](CC2CCCC2)CN(O)C=O)c(F)c(N2CCCO2)n1 |
| InChI | InChI=1S/C19H29FN6O4/c1-2-15-21-17(16(20)18(22-15)26-8-5-9-30-26)23-24-19(28)14(11-25(29)12-27)10-13-6-3-4-7-13/h12-14,29H,2-11H2,1H3,(H,24,28)(H,21,22,23)/t14-/m1/s1 |
| InChIKey | HTGJKBFKHDTUOI-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|