About butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate
butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate (PubChem CID 58001729) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate.
Molecular Properties
| Compound Name | butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate |
| PubChem CID | 58001729 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(OC)nc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H26N2O4/c1-6-7-12-24-15(21)11-9-13-8-10-14(23-5)19-16(13)20-17(22)18(2,3)4/h8-11H,6-7,12H2,1-5H3,(H,19,20,22)/b11-9+ |
| InChIKey | XUECDHSOPGFZRO-PKNBQFBNSA-N |
| XLogP | 3.43 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate?
The IUPAC name of butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate (CID 58001729) is butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate.
What is the SMILES notation for butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate?
The canonical SMILES for butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate is CCCCOC(=O)/C=C/c1ccc(OC)nc1NC(=O)C(C)(C)C.
What is the InChIKey of butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate?
The InChIKey is XUECDHSOPGFZRO-PKNBQFBNSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-6-7-12-24-15(21)11-9-13-8-10-14(23-5)19-16(13)20-17(22)18(2,3)4/h8-11H,6-7,12H2,1-5H3,(H,19,20,22)/b11-9+.
What are the key properties of butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate?
butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate has a molecular weight of 334.42 g/mol, XLogP of 3.43, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (E)-3-[2-(2,2-dimethylpropanoylamino)-6-methoxy-3-pyridinyl]prop-2-enoate is sourced from PubChem (CID 58001729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).