About 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one
6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 58001792) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 58001792 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | COc1ccc2c(n1)NC(=O)CN2 |
| InChI | InChI=1S/C8H9N3O2/c1-13-7-3-2-5-8(11-7)10-6(12)4-9-5/h2-3,9H,4H2,1H3,(H,10,11,12) |
| InChIKey | QBANBRWELABETG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one (CID 58001792) is 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one is COc1ccc2c(n1)NC(=O)CN2.
What is the InChIKey of 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The InChIKey is QBANBRWELABETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-13-7-3-2-5-8(11-7)10-6(12)4-9-5/h2-3,9H,4H2,1H3,(H,10,11,12).
What are the key properties of 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one has a molecular weight of 179.18 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 58001792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).