About 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde
5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde (PubChem CID 58003023) has the molecular formula C21H21FO3
and a molecular weight of 340.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde |
| PubChem CID | 58003023 |
| Molecular Formula | C21H21FO3 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde |
| SMILES | CC(C)c1cc2c(c(-c3ccc(F)cc3)c1C=O)C(=O)CC(C)(C)O2 |
| InChI | InChI=1S/C21H21FO3/c1-12(2)15-9-18-20(17(24)10-21(3,4)25-18)19(16(15)11-23)13-5-7-14(22)8-6-13/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | LWKQJHAJDRYODY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde?
The IUPAC name of 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde (CID 58003023) is 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde.
What is the SMILES notation for 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde?
The canonical SMILES for 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde is CC(C)c1cc2c(c(-c3ccc(F)cc3)c1C=O)C(=O)CC(C)(C)O2.
What is the InChIKey of 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde?
The InChIKey is LWKQJHAJDRYODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FO3/c1-12(2)15-9-18-20(17(24)10-21(3,4)25-18)19(16(15)11-23)13-5-7-14(22)8-6-13/h5-9,11-12H,10H2,1-4H3.
What are the key properties of 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde?
5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde has a molecular weight of 340.39 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2,2-dimethyl-4-oxo-7-propan-2-yl-3H-chromene-6-carbaldehyde is sourced from PubChem (CID 58003023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).