About (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate
(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58003165) has the molecular formula C20H29F3O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 58003165 |
| Molecular Formula | C20H29F3O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC1(OC(=O)C(C)(CC)C(F)(F)F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C20H29F3O2/c1-4-18(3,20(21,22)23)17(24)25-19(5-2)10-13-9-14(19)16-12-7-6-11(8-12)15(13)16/h11-16H,4-10H2,1-3H3 |
| InChIKey | HPKCVDHMLJWHOU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate (CID 58003165) is (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate is CCC1(OC(=O)C(C)(CC)C(F)(F)F)CC2CC1C1C3CCC(C3)C21.
What is the InChIKey of (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is HPKCVDHMLJWHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F3O2/c1-4-18(3,20(21,22)23)17(24)25-19(5-2)10-13-9-14(19)16-12-7-6-11(8-12)15(13)16/h11-16H,4-10H2,1-3H3.
What are the key properties of (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate?
(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 358.44 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 58003165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).