About (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate
(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58003167) has the molecular formula C18H27F3O2
and a molecular weight of 332.41 g/mol. Its IUPAC name is (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 58003167 |
| Molecular Formula | C18H27F3O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC1(OC(=O)C(C)(CC)C(F)(F)F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C18H27F3O2/c1-4-16(3,18(19,20)21)15(22)23-17(5-2)10-11-9-14(17)13-8-6-7-12(11)13/h11-14H,4-10H2,1-3H3 |
| InChIKey | QJBGEADEMPFGLD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate (CID 58003167) is (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate is CCC1(OC(=O)C(C)(CC)C(F)(F)F)CC2CC1C1CCCC21.
What is the InChIKey of (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is QJBGEADEMPFGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F3O2/c1-4-16(3,18(19,20)21)15(22)23-17(5-2)10-11-9-14(17)13-8-6-7-12(11)13/h11-14H,4-10H2,1-3H3.
What are the key properties of (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate?
(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 332.41 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 58003167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).