C21H28O4 — CID 58003190
(5R,8S)-2-[(1E,5E)-deca-1,5,9-trienyl]-4-ethenyl-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione (PubChem CID 58003190) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (5R,8S)-2-[(1E,5E)-deca-1,5,9-trienyl]-4-ethenyl-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione.
| Compound Name | (5R,8S)-2-[(1E,5E)-deca-1,5,9-trienyl]-4-ethenyl-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 58003190 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (5R,8S)-2-[(1E,5E)-deca-1,5,9-trienyl]-4-ethenyl-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione |
| SMILES | C=CCC/C=C/CC/C=C/C1CC(C=C)[C@@]2(C1)OC(=O)[C@H](C)OC2=O |
| InChI | InChI=1S/C21H28O4/c1-4-6-7-8-9-10-11-12-13-17-14-18(5-2)21(15-17)20(23)24-16(3)19(22)25-21/h4-5,8-9,12-13,16-18H,1-2,6-7,10-11,14-15H2,3H3/b9-8+,13-12+/t16-,17?,18?,21+/m0/s1 |
| InChIKey | HOKWFSQTDZTPKG-NOVYYONQSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|