C36H58N2O5 — CID 58003310
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-2-prop-2-enylpropanedioate (PubChem CID 58003310) has the molecular formula C36H58N2O5 and a molecular weight of 598.87 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-2-prop-2-enylpropanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 58003310 |
| Molecular Formula | C36H58N2O5 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.43 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(Cc1cc(C)c(O)c(C(C)(C)C)c1)(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C36H58N2O5/c1-14-15-36(18-24-16-23(2)28(39)27(17-24)31(3,4)5,29(40)42-25-19-32(6,7)37-33(8,9)20-25)30(41)43-26-21-34(10,11)38-35(12,13)22-26/h14,16-17,25-26,37-39H,1,15,18-22H2,2-13H3 |
| InChIKey | KMEPBEJIQGQXHO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|