C16H9F6NS — CID 58003581
4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 58003581) has the molecular formula C16H9F6NS and a molecular weight of 361.31 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 58003581 |
| Molecular Formula | C16H9F6NS |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)C(c1ccc(-c2cccc3scnc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H9F6NS/c17-15(18,19)14(16(20,21)22)10-6-4-9(5-7-10)11-2-1-3-12-13(11)23-8-24-12/h1-8,14H |
| InChIKey | KVDVBHKCRWZPRC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |