C43H28Br2N4O2 — CID 58003954
5,10-dibromo-2-[4-[2-(2,3-diphenylquinoxalin-6-yl)oxyethoxy]phenyl]-1H-phenanthro[9,10-d]imidazole (PubChem CID 58003954) has the molecular formula C43H28Br2N4O2 and a molecular weight of 792.53 g/mol. Its IUPAC name is 5,10-dibromo-2-[4-[2-(2,3-diphenylquinoxalin-6-yl)oxyethoxy]phenyl]-1H-phenanthro[9,10-d]imidazole.
| Compound Name | 5,10-dibromo-2-[4-[2-(2,3-diphenylquinoxalin-6-yl)oxyethoxy]phenyl]-1H-phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 58003954 |
| Molecular Formula | C43H28Br2N4O2 |
| Molecular Weight | 792.53 g/mol |
| Exact Mass | 790.06 |
| IUPAC Name | 5,10-dibromo-2-[4-[2-(2,3-diphenylquinoxalin-6-yl)oxyethoxy]phenyl]-1H-phenanthro[9,10-d]imidazole |
| SMILES | Brc1ccc2c3ccc(Br)cc3c3[nH]c(-c4ccc(OCCOc5ccc6nc(-c7ccccc7)c(-c7ccccc7)nc6c5)cc4)nc3c2c1 |
| InChI | InChI=1S/C43H28Br2N4O2/c44-29-13-18-33-34-19-14-30(45)24-36(34)42-41(35(33)23-29)48-43(49-42)28-11-15-31(16-12-28)50-21-22-51-32-17-20-37-38(25-32)47-40(27-9-5-2-6-10-27)39(46-37)26-7-3-1-4-8-26/h1-20,23-25H,21-22H2,(H,48,49) |
| InChIKey | WDGRESXJHWIRKR-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.53 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|