C15H30N2OS — CID 58004827
1-(1-methoxypropan-2-yl)-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea (PubChem CID 58004827) has the molecular formula C15H30N2OS and a molecular weight of 286.49 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 58004827 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
| SMILES | COCC(C)NC(=S)N[C@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C15H30N2OS/c1-10(2)13-7-6-11(3)8-14(13)17-15(19)16-12(4)9-18-5/h10-14H,6-9H2,1-5H3,(H2,16,17,19)/t11-,12?,13+,14+/m1/s1 |
| InChIKey | BTSRICGQIRSLMD-KRCVMZOZSA-N |
| XLogP | 2.95 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|